About 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane
5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane (PubChem CID 171407041) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane |
| PubChem CID | 171407041 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane |
| SMILES | CC(C)(C)CN1CCN(C(C)(C)C)C2(COC2)C1 |
| InChI | InChI=1S/C15H30N2O/c1-13(2,3)9-16-7-8-17(14(4,5)6)15(10-16)11-18-12-15/h7-12H2,1-6H3 |
| InChIKey | POJBGXNXQRUSJR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane?
The IUPAC name of 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane (CID 171407041) is 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane.
What is the SMILES notation for 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane?
The canonical SMILES for 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane is CC(C)(C)CN1CCN(C(C)(C)C)C2(COC2)C1.
What is the InChIKey of 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane?
The InChIKey is POJBGXNXQRUSJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O/c1-13(2,3)9-16-7-8-17(14(4,5)6)15(10-16)11-18-12-15/h7-12H2,1-6H3.
What are the key properties of 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane?
5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane has a molecular weight of 254.42 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-8-(2,2-dimethylpropyl)-2-oxa-5,8-diazaspiro[3.5]nonane is sourced from PubChem (CID 171407041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).