C21H27ClN6O3S — CID 174297737
N-[4-[6-chloro-3-(2-piperidin-1-ylethylamino)pyrazolo[4,3-c]pyridin-1-yl]-3-methoxyphenyl]methanesulfonamide (PubChem CID 174297737) has the molecular formula C21H27ClN6O3S and a molecular weight of 479.01 g/mol. Its IUPAC name is N-[4-[6-chloro-3-(2-piperidin-1-ylethylamino)pyrazolo[4,3-c]pyridin-1-yl]-3-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[4-[6-chloro-3-(2-piperidin-1-ylethylamino)pyrazolo[4,3-c]pyridin-1-yl]-3-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 174297737 |
| Molecular Formula | C21H27ClN6O3S |
| Molecular Weight | 479.01 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[4-[6-chloro-3-(2-piperidin-1-ylethylamino)pyrazolo[4,3-c]pyridin-1-yl]-3-methoxyphenyl]methanesulfonamide |
| SMILES | COc1cc(NS(C)(=O)=O)ccc1-n1nc(NCCN2CCCCC2)c2cnc(Cl)cc21 |
| InChI | InChI=1S/C21H27ClN6O3S/c1-31-19-12-15(26-32(2,29)30)6-7-17(19)28-18-13-20(22)24-14-16(18)21(25-28)23-8-11-27-9-4-3-5-10-27/h6-7,12-14,26H,3-5,8-11H2,1-2H3,(H,23,25) |
| InChIKey | XUVHWBHSLSPGDF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.01 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|