C19H25ClN6O3S — CID 174297762
4-[6-chloro-3-[3-(dimethylamino)propylamino]pyrazolo[4,3-c]pyridin-1-yl]-3-methoxy-N-methylbenzenesulfonamide (PubChem CID 174297762) has the molecular formula C19H25ClN6O3S and a molecular weight of 452.97 g/mol. Its IUPAC name is 4-[6-chloro-3-[3-(dimethylamino)propylamino]pyrazolo[4,3-c]pyridin-1-yl]-3-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 4-[6-chloro-3-[3-(dimethylamino)propylamino]pyrazolo[4,3-c]pyridin-1-yl]-3-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 174297762 |
| Molecular Formula | C19H25ClN6O3S |
| Molecular Weight | 452.97 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-[6-chloro-3-[3-(dimethylamino)propylamino]pyrazolo[4,3-c]pyridin-1-yl]-3-methoxy-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(-n2nc(NCCCN(C)C)c3cnc(Cl)cc32)c(OC)c1 |
| InChI | InChI=1S/C19H25ClN6O3S/c1-21-30(27,28)13-6-7-15(17(10-13)29-4)26-16-11-18(20)23-12-14(16)19(24-26)22-8-5-9-25(2)3/h6-7,10-12,21H,5,8-9H2,1-4H3,(H,22,24) |
| InChIKey | WVEUOUJFEOOFHN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.97 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|