C16H21ClN4O3S — CID 113010810
3-chloro-N-[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]-4-methoxybenzenesulfonamide (PubChem CID 113010810) has the molecular formula C16H21ClN4O3S and a molecular weight of 384.89 g/mol. Its IUPAC name is 3-chloro-N-[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113010810 |
| Molecular Formula | C16H21ClN4O3S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 3-chloro-N-[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(NCCN(C)C)nc2)cc1Cl |
| InChI | InChI=1S/C16H21ClN4O3S/c1-21(2)9-8-18-16-7-4-12(11-19-16)20-25(22,23)13-5-6-15(24-3)14(17)10-13/h4-7,10-11,20H,8-9H2,1-3H3,(H,18,19) |
| InChIKey | HWDMVPAXJUSTLK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |