C11H18FN — CID 174300924
(4E)-4-(1-fluoro-3-methylbut-3-enylidene)-2,2-dimethylpyrrolidine (PubChem CID 174300924) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is (4E)-4-(1-fluoro-3-methylbut-3-enylidene)-2,2-dimethylpyrrolidine.
| Compound Name | (4E)-4-(1-fluoro-3-methylbut-3-enylidene)-2,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 174300924 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (4E)-4-(1-fluoro-3-methylbut-3-enylidene)-2,2-dimethylpyrrolidine |
| SMILES | C=C(C)C/C(F)=C1\CNC(C)(C)C1 |
| InChI | InChI=1S/C11H18FN/c1-8(2)5-10(12)9-6-11(3,4)13-7-9/h13H,1,5-7H2,2-4H3/b10-9+ |
| InChIKey | XRIYQESIIMZRMT-MDZDMXLPSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|