C15H21ClN2O — CID 174302962
bicyclo[3.1.0]hexane;1-(2-chlorophenyl)ethylurea (PubChem CID 174302962) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is bicyclo[3.1.0]hexane;1-(2-chlorophenyl)ethylurea.
| Compound Name | bicyclo[3.1.0]hexane;1-(2-chlorophenyl)ethylurea |
|---|---|
| PubChem CID | 174302962 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | bicyclo[3.1.0]hexane;1-(2-chlorophenyl)ethylurea |
| SMILES | C1CC2CC2C1.CC(NC(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C9H11ClN2O.C6H10/c1-6(12-9(11)13)7-4-2-3-5-8(7)10;1-2-5-4-6(5)3-1/h2-6H,1H3,(H3,11,12,13);5-6H,1-4H2 |
| InChIKey | VYXZBGHOSSXKSO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |