C24H23FN4O2 — CID 17430545
cyclopropyl-[4-[3-(4-fluorophenyl)-1-phenylpyrazole-4-carbonyl]piperazin-1-yl]methanone (PubChem CID 17430545) has the molecular formula C24H23FN4O2 and a molecular weight of 418.47 g/mol. Its IUPAC name is cyclopropyl-[4-[3-(4-fluorophenyl)-1-phenylpyrazole-4-carbonyl]piperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[3-(4-fluorophenyl)-1-phenylpyrazole-4-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17430545 |
| Molecular Formula | C24H23FN4O2 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | cyclopropyl-[4-[3-(4-fluorophenyl)-1-phenylpyrazole-4-carbonyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cn(-c2ccccc2)nc1-c1ccc(F)cc1)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C24H23FN4O2/c25-19-10-8-17(9-11-19)22-21(16-29(26-22)20-4-2-1-3-5-20)24(31)28-14-12-27(13-15-28)23(30)18-6-7-18/h1-5,8-11,16,18H,6-7,12-15H2 |
| InChIKey | RTQBDAXOOFNDDU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |