C28H32N4O2 — CID 46377856
2-[1-(1,3-diphenylpyrazole-4-carbonyl)piperidin-4-yl]-1-piperidin-1-ylethanone (PubChem CID 46377856) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 2-[1-(1,3-diphenylpyrazole-4-carbonyl)piperidin-4-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[1-(1,3-diphenylpyrazole-4-carbonyl)piperidin-4-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 46377856 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 2-[1-(1,3-diphenylpyrazole-4-carbonyl)piperidin-4-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CC1CCN(C(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C28H32N4O2/c33-26(30-16-8-3-9-17-30)20-22-14-18-31(19-15-22)28(34)25-21-32(24-12-6-2-7-13-24)29-27(25)23-10-4-1-5-11-23/h1-2,4-7,10-13,21-22H,3,8-9,14-20H2 |
| InChIKey | WQZVQPQFCIXDJQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |