C25H28N4O2 — CID 55781057
N-[[1-[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]piperidin-4-yl]methyl]acetamide (PubChem CID 55781057) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[[1-[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]piperidin-4-yl]methyl]acetamide.
| Compound Name | N-[[1-[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 55781057 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[[1-[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]piperidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCN(C(=O)c2cn(-c3ccc(C)cc3)nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N4O2/c1-18-8-10-22(11-9-18)29-17-23(24(27-29)21-6-4-3-5-7-21)25(31)28-14-12-20(13-15-28)16-26-19(2)30/h3-11,17,20H,12-16H2,1-2H3,(H,26,30) |
| InChIKey | SWNDXQPSFKVEQC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |