C31H36N4O2 — CID 46377850
N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(1,3-diphenylpyrazole-4-carbonyl)piperidin-4-yl]acetamide (PubChem CID 46377850) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(1,3-diphenylpyrazole-4-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(1,3-diphenylpyrazole-4-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 46377850 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(1,3-diphenylpyrazole-4-carbonyl)piperidin-4-yl]acetamide |
| SMILES | O=C(CC1CCN(C(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)CC1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C31H36N4O2/c36-29(32-19-16-24-10-4-1-5-11-24)22-25-17-20-34(21-18-25)31(37)28-23-35(27-14-8-3-9-15-27)33-30(28)26-12-6-2-7-13-26/h2-3,6-10,12-15,23,25H,1,4-5,11,16-22H2,(H,32,36) |
| InChIKey | FIJGOHCXLJTNEO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|