C10H12FNO — CID 174307651
(2E,4Z)-1-fluoro-1-(furan-2-yl)hexa-2,4-dien-3-amine (PubChem CID 174307651) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is (2E,4Z)-1-fluoro-1-(furan-2-yl)hexa-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-1-fluoro-1-(furan-2-yl)hexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 174307651 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (2E,4Z)-1-fluoro-1-(furan-2-yl)hexa-2,4-dien-3-amine |
| SMILES | C/C=C\C(N)=C/C(F)c1ccco1 |
| InChI | InChI=1S/C10H12FNO/c1-2-4-8(12)7-9(11)10-5-3-6-13-10/h2-7,9H,12H2,1H3/b4-2-,8-7+ |
| InChIKey | RGIPKFDTLXBVNH-NJHWQUGTSA-N |
| XLogP | 2.71 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|