C48H39N3 — CID 174309678
4-[2-[(E)-1-[[amino(phenyl)methyl]amino]-3-[3-(11,11-dimethylbenzo[b]fluoren-4-yl)phenyl]prop-2-enyl]phenyl]benzonitrile (PubChem CID 174309678) has the molecular formula C48H39N3 and a molecular weight of 657.86 g/mol. Its IUPAC name is 4-[2-[(E)-1-[[amino(phenyl)methyl]amino]-3-[3-(11,11-dimethylbenzo[b]fluoren-4-yl)phenyl]prop-2-enyl]phenyl]benzonitrile.
| Compound Name | 4-[2-[(E)-1-[[amino(phenyl)methyl]amino]-3-[3-(11,11-dimethylbenzo[b]fluoren-4-yl)phenyl]prop-2-enyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 174309678 |
| Molecular Formula | C48H39N3 |
| Molecular Weight | 657.86 g/mol |
| Exact Mass | 657.31 |
| IUPAC Name | 4-[2-[(E)-1-[[amino(phenyl)methyl]amino]-3-[3-(11,11-dimethylbenzo[b]fluoren-4-yl)phenyl]prop-2-enyl]phenyl]benzonitrile |
| SMILES | CC1(C)c2cc3ccccc3cc2-c2c(-c3cccc(/C=C/C(NC(N)c4ccccc4)c4ccccc4-c4ccc(C#N)cc4)c3)cccc21 |
| InChI | InChI=1S/C48H39N3/c1-48(2)43-21-11-20-40(46(43)42-29-36-15-6-7-16-37(36)30-44(42)48)38-17-10-12-32(28-38)24-27-45(51-47(50)35-13-4-3-5-14-35)41-19-9-8-18-39(41)34-25-22-33(31-49)23-26-34/h3-30,45,47,51H,50H2,1-2H3/b27-24+ |
| InChIKey | QQLUUXOPFPDDPN-SOYKGTTHSA-N |
| XLogP | 11.35 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.86 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|