C45H38N3+ — CID 174310098
N'-[(Z)-1-[3-(11,11-dimethylbenzo[b]fluoren-4-yl)phenyl]-3-(4-pyrrol-1-ium-3-ylphenyl)prop-1-enyl]-1-phenylmethanediamine (PubChem CID 174310098) has the molecular formula C45H38N3+ and a molecular weight of 620.82 g/mol. Its IUPAC name is N'-[(Z)-1-[3-(11,11-dimethylbenzo[b]fluoren-4-yl)phenyl]-3-(4-pyrrol-1-ium-3-ylphenyl)prop-1-enyl]-1-phenylmethanediamine.
| Compound Name | N'-[(Z)-1-[3-(11,11-dimethylbenzo[b]fluoren-4-yl)phenyl]-3-(4-pyrrol-1-ium-3-ylphenyl)prop-1-enyl]-1-phenylmethanediamine |
|---|---|
| PubChem CID | 174310098 |
| Molecular Formula | C45H38N3+ |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | N'-[(Z)-1-[3-(11,11-dimethylbenzo[b]fluoren-4-yl)phenyl]-3-(4-pyrrol-1-ium-3-ylphenyl)prop-1-enyl]-1-phenylmethanediamine |
| SMILES | CC1(C)c2cc3ccccc3cc2-c2c(-c3cccc(/C(=C/Cc4ccc(C5=CC=[N+]=C5)cc4)NC(N)c4ccccc4)c3)cccc21 |
| InChI | InChI=1S/C45H38N3/c1-45(2)40-17-9-16-38(43(40)39-27-33-12-6-7-13-34(33)28-41(39)45)35-14-8-15-36(26-35)42(48-44(46)32-10-4-3-5-11-32)23-20-30-18-21-31(22-19-30)37-24-25-47-29-37/h3-19,21-29,44,48H,20,46H2,1-2H3/q+1/b42-23- |
| InChIKey | VPSLYFFGMHHTQC-PMHDSTOGSA-N |
| XLogP | 9.25 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|