C13H14N4O2S — CID 17431097
3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanyloxolan-2-one (PubChem CID 17431097) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanyloxolan-2-one.
| Compound Name | 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanyloxolan-2-one |
|---|---|
| PubChem CID | 17431097 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanyloxolan-2-one |
| SMILES | Cc1cccc(C)c1-n1nnnc1SC1CCOC1=O |
| InChI | InChI=1S/C13H14N4O2S/c1-8-4-3-5-9(2)11(8)17-13(14-15-16-17)20-10-6-7-19-12(10)18/h3-5,10H,6-7H2,1-2H3 |
| InChIKey | LLXLKBVQBQNNPX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |