C24H33N7OS — CID 174312719
4-[3-methyl-4-(1-propan-2-ylpiperidin-4-yl)oxy-2H-pyrazolo[3,4-d]pyrimidin-6-yl]-N-pyrrolidin-1-ylsulfanylaniline (PubChem CID 174312719) has the molecular formula C24H33N7OS and a molecular weight of 467.64 g/mol. Its IUPAC name is 4-[3-methyl-4-(1-propan-2-ylpiperidin-4-yl)oxy-2H-pyrazolo[3,4-d]pyrimidin-6-yl]-N-pyrrolidin-1-ylsulfanylaniline.
| Compound Name | 4-[3-methyl-4-(1-propan-2-ylpiperidin-4-yl)oxy-2H-pyrazolo[3,4-d]pyrimidin-6-yl]-N-pyrrolidin-1-ylsulfanylaniline |
|---|---|
| PubChem CID | 174312719 |
| Molecular Formula | C24H33N7OS |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 4-[3-methyl-4-(1-propan-2-ylpiperidin-4-yl)oxy-2H-pyrazolo[3,4-d]pyrimidin-6-yl]-N-pyrrolidin-1-ylsulfanylaniline |
| SMILES | Cc1[nH]nc2nc(-c3ccc(NSN4CCCC4)cc3)nc(OC3CCN(C(C)C)CC3)c12 |
| InChI | InChI=1S/C24H33N7OS/c1-16(2)30-14-10-20(11-15-30)32-24-21-17(3)27-28-23(21)25-22(26-24)18-6-8-19(9-7-18)29-33-31-12-4-5-13-31/h6-9,16,20,29H,4-5,10-15H2,1-3H3,(H,25,26,27,28) |
| InChIKey | MYQMESGZWUEDKM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|