C26H30ClFN6OS — CID 164580778
2-[4-[(5-chloro-2-fluorophenyl)sulfanylamino]phenyl]-5-ethanimidoyl-6-(1-propan-2-ylpiperidin-4-yl)oxypyrimidin-4-amine (PubChem CID 164580778) has the molecular formula C26H30ClFN6OS and a molecular weight of 529.09 g/mol. Its IUPAC name is 2-[4-[(5-chloro-2-fluorophenyl)sulfanylamino]phenyl]-5-ethanimidoyl-6-(1-propan-2-ylpiperidin-4-yl)oxypyrimidin-4-amine.
| Compound Name | 2-[4-[(5-chloro-2-fluorophenyl)sulfanylamino]phenyl]-5-ethanimidoyl-6-(1-propan-2-ylpiperidin-4-yl)oxypyrimidin-4-amine |
|---|---|
| PubChem CID | 164580778 |
| Molecular Formula | C26H30ClFN6OS |
| Molecular Weight | 529.09 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 2-[4-[(5-chloro-2-fluorophenyl)sulfanylamino]phenyl]-5-ethanimidoyl-6-(1-propan-2-ylpiperidin-4-yl)oxypyrimidin-4-amine |
| SMILES | [H]/N=C(\C)c1c(N)nc(-c2ccc(NSc3cc(Cl)ccc3F)cc2)nc1OC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C26H30ClFN6OS/c1-15(2)34-12-10-20(11-13-34)35-26-23(16(3)29)24(30)31-25(32-26)17-4-7-19(8-5-17)33-36-22-14-18(27)6-9-21(22)28/h4-9,14-15,20,29,33H,10-13H2,1-3H3,(H2,30,31,32)/b29-16+ |
| InChIKey | RAPRJHRRJWMEES-MUFRIFMGSA-N |
| XLogP | 6.28 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.09 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|