C24H25ClF2N6OS — CID 170725047
2-[3-chloro-4-[(2,5-difluorophenyl)sulfanylamino]phenyl]-5-ethanimidoyl-6-(1-methylpiperidin-4-yl)oxypyrimidin-4-amine (PubChem CID 170725047) has the molecular formula C24H25ClF2N6OS and a molecular weight of 519.02 g/mol. Its IUPAC name is 2-[3-chloro-4-[(2,5-difluorophenyl)sulfanylamino]phenyl]-5-ethanimidoyl-6-(1-methylpiperidin-4-yl)oxypyrimidin-4-amine.
| Compound Name | 2-[3-chloro-4-[(2,5-difluorophenyl)sulfanylamino]phenyl]-5-ethanimidoyl-6-(1-methylpiperidin-4-yl)oxypyrimidin-4-amine |
|---|---|
| PubChem CID | 170725047 |
| Molecular Formula | C24H25ClF2N6OS |
| Molecular Weight | 519.02 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 2-[3-chloro-4-[(2,5-difluorophenyl)sulfanylamino]phenyl]-5-ethanimidoyl-6-(1-methylpiperidin-4-yl)oxypyrimidin-4-amine |
| SMILES | [H]/N=C(\C)c1c(N)nc(-c2ccc(NSc3cc(F)ccc3F)c(Cl)c2)nc1OC1CCN(C)CC1 |
| InChI | InChI=1S/C24H25ClF2N6OS/c1-13(28)21-22(29)30-23(31-24(21)34-16-7-9-33(2)10-8-16)14-3-6-19(17(25)11-14)32-35-20-12-15(26)4-5-18(20)27/h3-6,11-12,16,28,32H,7-10H2,1-2H3,(H2,29,30,31)/b28-13+ |
| InChIKey | IIWHRCFXOAEGPS-XODNFHPESA-N |
| XLogP | 5.64 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.02 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|