C27H40ClFN7O2PS2 — CID 170725059
2-[2-[[6-amino-2-[4-[(5-chloro-2-fluorophenyl)sulfanylamino]phenyl]-5-ethanimidoylpyrimidin-4-yl]amino]ethyl-methylamino]ethoxyphosphinous acid;methanethiol;propane (PubChem CID 170725059) has the molecular formula C27H40ClFN7O2PS2 and a molecular weight of 644.22 g/mol. Its IUPAC name is 2-[2-[[6-amino-2-[4-[(5-chloro-2-fluorophenyl)sulfanylamino]phenyl]-5-ethanimidoylpyrimidin-4-yl]amino]ethyl-methylamino]ethoxyphosphinous acid;methanethiol;propane.
| Compound Name | 2-[2-[[6-amino-2-[4-[(5-chloro-2-fluorophenyl)sulfanylamino]phenyl]-5-ethanimidoylpyrimidin-4-yl]amino]ethyl-methylamino]ethoxyphosphinous acid;methanethiol;propane |
|---|---|
| PubChem CID | 170725059 |
| Molecular Formula | C27H40ClFN7O2PS2 |
| Molecular Weight | 644.22 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | 2-[2-[[6-amino-2-[4-[(5-chloro-2-fluorophenyl)sulfanylamino]phenyl]-5-ethanimidoylpyrimidin-4-yl]amino]ethyl-methylamino]ethoxyphosphinous acid;methanethiol;propane |
| SMILES | CCC.CS.[H]/N=C(\C)c1c(N)nc(-c2ccc(NSc3cc(Cl)ccc3F)cc2)nc1NCCN(C)CCOPO |
| InChI | InChI=1S/C23H28ClFN7O2PS.C3H8.CH4S/c1-14(26)20-21(27)29-22(30-23(20)28-9-10-32(2)11-12-34-35-33)15-3-6-17(7-4-15)31-36-19-13-16(24)5-8-18(19)25;1-3-2;1-2/h3-8,13,26,31,33,35H,9-12H2,1-2H3,(H3,27,28,29,30);3H2,1-2H3;2H,1H3/b26-14+;; |
| InChIKey | ZYLSASREOHARMX-AHSVGKDMSA-N |
| XLogP | 6.85 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.22 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|