C57H53NO — CID 174314025
6-cyclohexyl-N,N-bis(9,9-dimethylfluoren-2-yl)-8-(2,4,6-trimethylphenyl)dibenzofuran-4-amine (PubChem CID 174314025) has the molecular formula C57H53NO and a molecular weight of 768.06 g/mol. Its IUPAC name is 6-cyclohexyl-N,N-bis(9,9-dimethylfluoren-2-yl)-8-(2,4,6-trimethylphenyl)dibenzofuran-4-amine.
| Compound Name | 6-cyclohexyl-N,N-bis(9,9-dimethylfluoren-2-yl)-8-(2,4,6-trimethylphenyl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 174314025 |
| Molecular Formula | C57H53NO |
| Molecular Weight | 768.06 g/mol |
| Exact Mass | 767.41 |
| IUPAC Name | 6-cyclohexyl-N,N-bis(9,9-dimethylfluoren-2-yl)-8-(2,4,6-trimethylphenyl)dibenzofuran-4-amine |
| SMILES | Cc1cc(C)c(-c2cc(C3CCCCC3)c3oc4c(N(c5ccc6c(c5)C(C)(C)c5ccccc5-6)c5ccc6c(c5)C(C)(C)c5ccccc5-6)cccc4c3c2)c(C)c1 |
| InChI | InChI=1S/C57H53NO/c1-34-28-35(2)53(36(3)29-34)38-30-46(37-16-9-8-10-17-37)54-47(31-38)45-20-15-23-52(55(45)59-54)58(39-24-26-43-41-18-11-13-21-48(41)56(4,5)50(43)32-39)40-25-27-44-42-19-12-14-22-49(42)57(6,7)51(44)33-40/h11-15,18-33,37H,8-10,16-17H2,1-7H3 |
| InChIKey | PKLZCPLBBRMXPC-UHFFFAOYSA-N |
| XLogP | 16.31 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.06 |
| LogP ≤ 5 | 16.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |