C23H21ClN2O3S — CID 174315454
N-[2-[2-(3-chloro-4-pyridinyl)ethenyl]phenyl]-1-(4-methoxyphenyl)prop-2-ene-1-sulfonamide (PubChem CID 174315454) has the molecular formula C23H21ClN2O3S and a molecular weight of 440.95 g/mol. Its IUPAC name is N-[2-[2-(3-chloro-4-pyridinyl)ethenyl]phenyl]-1-(4-methoxyphenyl)prop-2-ene-1-sulfonamide.
| Compound Name | N-[2-[2-(3-chloro-4-pyridinyl)ethenyl]phenyl]-1-(4-methoxyphenyl)prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 174315454 |
| Molecular Formula | C23H21ClN2O3S |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-[2-[2-(3-chloro-4-pyridinyl)ethenyl]phenyl]-1-(4-methoxyphenyl)prop-2-ene-1-sulfonamide |
| SMILES | C=CC(c1ccc(OC)cc1)S(=O)(=O)Nc1ccccc1C=Cc1ccncc1Cl |
| InChI | InChI=1S/C23H21ClN2O3S/c1-3-23(19-10-12-20(29-2)13-11-19)30(27,28)26-22-7-5-4-6-18(22)9-8-17-14-15-25-16-21(17)24/h3-16,23,26H,1H2,2H3 |
| InChIKey | YVJYJWDGXDZHDO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|