C19H24F3N5O3 — CID 174316908
(4aR,8aS)-6-[4-[[5-(trifluoromethyl)pyrimidin-2-yl]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 174316908) has the molecular formula C19H24F3N5O3 and a molecular weight of 427.43 g/mol. Its IUPAC name is (4aR,8aS)-6-[4-[[5-(trifluoromethyl)pyrimidin-2-yl]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR,8aS)-6-[4-[[5-(trifluoromethyl)pyrimidin-2-yl]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 174316908 |
| Molecular Formula | C19H24F3N5O3 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (4aR,8aS)-6-[4-[[5-(trifluoromethyl)pyrimidin-2-yl]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CCC(Cc4ncc(C(F)(F)F)cn4)CC3)C[C@H]2N1 |
| InChI | InChI=1S/C19H24F3N5O3/c20-19(21,22)13-8-23-16(24-9-13)7-12-1-4-26(5-2-12)18(29)27-6-3-15-14(10-27)25-17(28)11-30-15/h8-9,12,14-15H,1-7,10-11H2,(H,25,28)/t14-,15+/m1/s1 |
| InChIKey | UGFLWDARMJJWNR-CABCVRRESA-N |
| XLogP | 1.46 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |