C26H34F2N4O3 — CID 174317549
(4aR,8aS)-6-[7-[[6-(1,1-difluorobut-3-enyl)-3-pyridinyl]methyl]-2-azaspiro[3.5]nonane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 174317549) has the molecular formula C26H34F2N4O3 and a molecular weight of 488.58 g/mol. Its IUPAC name is (4aR,8aS)-6-[7-[[6-(1,1-difluorobut-3-enyl)-3-pyridinyl]methyl]-2-azaspiro[3.5]nonane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR,8aS)-6-[7-[[6-(1,1-difluorobut-3-enyl)-3-pyridinyl]methyl]-2-azaspiro[3.5]nonane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 174317549 |
| Molecular Formula | C26H34F2N4O3 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | (4aR,8aS)-6-[7-[[6-(1,1-difluorobut-3-enyl)-3-pyridinyl]methyl]-2-azaspiro[3.5]nonane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | C=CCC(F)(F)c1ccc(CC2CCC3(CC2)CN(C(=O)N2CC[C@@H]4OCC(=O)N[C@@H]4C2)C3)cn1 |
| InChI | InChI=1S/C26H34F2N4O3/c1-2-8-26(27,28)22-4-3-19(13-29-22)12-18-5-9-25(10-6-18)16-32(17-25)24(34)31-11-7-21-20(14-31)30-23(33)15-35-21/h2-4,13,18,20-21H,1,5-12,14-17H2,(H,30,33)/t20-,21+/m1/s1 |
| InChIKey | JLPJNWNHUKZZAF-RTWAWAEBSA-N |
| XLogP | 3.49 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|