C21H25F3N4O4 — CID 170784711
6-[6-[[2-oxo-4-(trifluoromethyl)-1-pyridinyl]methyl]-2-azaspiro[3.3]heptane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 170784711) has the molecular formula C21H25F3N4O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 6-[6-[[2-oxo-4-(trifluoromethyl)-1-pyridinyl]methyl]-2-azaspiro[3.3]heptane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | 6-[6-[[2-oxo-4-(trifluoromethyl)-1-pyridinyl]methyl]-2-azaspiro[3.3]heptane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 170784711 |
| Molecular Formula | C21H25F3N4O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 6-[6-[[2-oxo-4-(trifluoromethyl)-1-pyridinyl]methyl]-2-azaspiro[3.3]heptane-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1COC2CCN(C(=O)N3CC4(CC(Cn5ccc(C(F)(F)F)cc5=O)C4)C3)CC2N1 |
| InChI | InChI=1S/C21H25F3N4O4/c22-21(23,24)14-1-3-26(18(30)5-14)8-13-6-20(7-13)11-28(12-20)19(31)27-4-2-16-15(9-27)25-17(29)10-32-16/h1,3,5,13,15-16H,2,4,6-12H2,(H,25,29) |
| InChIKey | OYFFHXZSCBEVBR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |