C21H25F4N3O4 — CID 174258262
(4aR)-6-[4-[[2-fluoro-4-(trifluoromethyl)phenoxy]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 174258262) has the molecular formula C21H25F4N3O4 and a molecular weight of 459.44 g/mol. Its IUPAC name is (4aR)-6-[4-[[2-fluoro-4-(trifluoromethyl)phenoxy]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR)-6-[4-[[2-fluoro-4-(trifluoromethyl)phenoxy]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 174258262 |
| Molecular Formula | C21H25F4N3O4 |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (4aR)-6-[4-[[2-fluoro-4-(trifluoromethyl)phenoxy]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1COC2CCN(C(=O)N3CCC(COc4ccc(C(F)(F)F)cc4F)CC3)C[C@H]2N1 |
| InChI | InChI=1S/C21H25F4N3O4/c22-15-9-14(21(23,24)25)1-2-17(15)31-11-13-3-6-27(7-4-13)20(30)28-8-5-18-16(10-28)26-19(29)12-32-18/h1-2,9,13,16,18H,3-8,10-12H2,(H,26,29)/t16-,18?/m1/s1 |
| InChIKey | VOQRZFFURXUHLC-PYUWXLGESA-N |
| XLogP | 2.64 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |