C19H21ClF3N3O4 — CID 146386879
(4aR,8aS)-6-[3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 146386879) has the molecular formula C19H21ClF3N3O4 and a molecular weight of 447.84 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR,8aS)-6-[3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 146386879 |
| Molecular Formula | C19H21ClF3N3O4 |
| Molecular Weight | 447.84 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | (4aR,8aS)-6-[3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CC(COc4ccc(C(F)(F)F)cc4Cl)C3)C[C@H]2N1 |
| InChI | InChI=1S/C19H21ClF3N3O4/c20-13-5-12(19(21,22)23)1-2-15(13)29-9-11-6-26(7-11)18(28)25-4-3-16-14(8-25)24-17(27)10-30-16/h1-2,5,11,14,16H,3-4,6-10H2,(H,24,27)/t14-,16+/m1/s1 |
| InChIKey | ZRLOBDSIRMIJBI-ZBFHGGJFSA-N |
| XLogP | 2.38 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.84 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |