C20H23Cl2F3N4O3 — CID 174258354
(4aR)-6-[3-[[[1-(2,4-dichlorophenyl)-2,2,2-trifluoroethyl]amino]methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 174258354) has the molecular formula C20H23Cl2F3N4O3 and a molecular weight of 495.33 g/mol. Its IUPAC name is (4aR)-6-[3-[[[1-(2,4-dichlorophenyl)-2,2,2-trifluoroethyl]amino]methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR)-6-[3-[[[1-(2,4-dichlorophenyl)-2,2,2-trifluoroethyl]amino]methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 174258354 |
| Molecular Formula | C20H23Cl2F3N4O3 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | (4aR)-6-[3-[[[1-(2,4-dichlorophenyl)-2,2,2-trifluoroethyl]amino]methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1COC2CCN(C(=O)N3CC(CNC(c4ccc(Cl)cc4Cl)C(F)(F)F)C3)C[C@H]2N1 |
| InChI | InChI=1S/C20H23Cl2F3N4O3/c21-12-1-2-13(14(22)5-12)18(20(23,24)25)26-6-11-7-29(8-11)19(31)28-4-3-16-15(9-28)27-17(30)10-32-16/h1-2,5,11,15-16,18,26H,3-4,6-10H2,(H,27,30)/t15-,16?,18?/m1/s1 |
| InChIKey | MTWMMMZYXLEOEK-KLHKWILBSA-N |
| XLogP | 2.83 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |