C20H24ClF2N3O3 — CID 139517758
(4aR)-6-[4-[(4-chlorophenyl)-difluoromethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 139517758) has the molecular formula C20H24ClF2N3O3 and a molecular weight of 427.88 g/mol. Its IUPAC name is (4aR)-6-[4-[(4-chlorophenyl)-difluoromethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR)-6-[4-[(4-chlorophenyl)-difluoromethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 139517758 |
| Molecular Formula | C20H24ClF2N3O3 |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (4aR)-6-[4-[(4-chlorophenyl)-difluoromethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1COC2CCN(C(=O)N3CCC(C(F)(F)c4ccc(Cl)cc4)CC3)C[C@H]2N1 |
| InChI | InChI=1S/C20H24ClF2N3O3/c21-15-3-1-13(2-4-15)20(22,23)14-5-8-25(9-6-14)19(28)26-10-7-17-16(11-26)24-18(27)12-29-17/h1-4,14,16-17H,5-12H2,(H,24,27)/t16-,17?/m1/s1 |
| InChIKey | MZOURDNESNYTHZ-TZHYSIJRSA-N |
| XLogP | 2.85 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |