C28H24F3N3O4S — CID 174322379
4-phenyl-1-[1-[1-[3-(trifluoromethyl)benzoyl]-2,3-dihydroindol-5-yl]prop-2-enylsulfonyl]imidazolidin-2-one (PubChem CID 174322379) has the molecular formula C28H24F3N3O4S and a molecular weight of 555.58 g/mol. Its IUPAC name is 4-phenyl-1-[1-[1-[3-(trifluoromethyl)benzoyl]-2,3-dihydroindol-5-yl]prop-2-enylsulfonyl]imidazolidin-2-one.
| Compound Name | 4-phenyl-1-[1-[1-[3-(trifluoromethyl)benzoyl]-2,3-dihydroindol-5-yl]prop-2-enylsulfonyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 174322379 |
| Molecular Formula | C28H24F3N3O4S |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 4-phenyl-1-[1-[1-[3-(trifluoromethyl)benzoyl]-2,3-dihydroindol-5-yl]prop-2-enylsulfonyl]imidazolidin-2-one |
| SMILES | C=CC(c1ccc2c(c1)CCN2C(=O)c1cccc(C(F)(F)F)c1)S(=O)(=O)N1CC(c2ccccc2)NC1=O |
| InChI | InChI=1S/C28H24F3N3O4S/c1-2-25(39(37,38)34-17-23(32-27(34)36)18-7-4-3-5-8-18)20-11-12-24-19(15-20)13-14-33(24)26(35)21-9-6-10-22(16-21)28(29,30)31/h2-12,15-16,23,25H,1,13-14,17H2,(H,32,36) |
| InChIKey | OFCHUPZFPVHBBT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|