C17H15F3O3 — CID 174322847
2-methyl-4-phenylmethoxy-5-(2,2,2-trifluoroethyl)benzoic acid (PubChem CID 174322847) has the molecular formula C17H15F3O3 and a molecular weight of 324.30 g/mol. Its IUPAC name is 2-methyl-4-phenylmethoxy-5-(2,2,2-trifluoroethyl)benzoic acid.
| Compound Name | 2-methyl-4-phenylmethoxy-5-(2,2,2-trifluoroethyl)benzoic acid |
|---|---|
| PubChem CID | 174322847 |
| Molecular Formula | C17H15F3O3 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-methyl-4-phenylmethoxy-5-(2,2,2-trifluoroethyl)benzoic acid |
| SMILES | Cc1cc(OCc2ccccc2)c(CC(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C17H15F3O3/c1-11-7-15(23-10-12-5-3-2-4-6-12)13(9-17(18,19)20)8-14(11)16(21)22/h2-8H,9-10H2,1H3,(H,21,22) |
| InChIKey | NYQNLGGGWCCKMD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |