About 4,8a-dimethyl-1H-cinnoline
4,8a-dimethyl-1H-cinnoline (PubChem CID 174325542) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 4,8a-dimethyl-1H-cinnoline.
Molecular Properties
| Compound Name | 4,8a-dimethyl-1H-cinnoline |
| PubChem CID | 174325542 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4,8a-dimethyl-1H-cinnoline |
| SMILES | CC1=C2C=CC=CC2(C)NN=C1 |
| InChI | InChI=1S/C10H12N2/c1-8-7-11-12-10(2)6-4-3-5-9(8)10/h3-7,12H,1-2H3 |
| InChIKey | ZJQHFBZAPXOWFV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,8a-dimethyl-1H-cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8a-dimethyl-1H-cinnoline?
The IUPAC name of 4,8a-dimethyl-1H-cinnoline (CID 174325542) is 4,8a-dimethyl-1H-cinnoline.
What is the SMILES notation for 4,8a-dimethyl-1H-cinnoline?
The canonical SMILES for 4,8a-dimethyl-1H-cinnoline is CC1=C2C=CC=CC2(C)NN=C1.
What is the InChIKey of 4,8a-dimethyl-1H-cinnoline?
The InChIKey is ZJQHFBZAPXOWFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-8-7-11-12-10(2)6-4-3-5-9(8)10/h3-7,12H,1-2H3.
What are the key properties of 4,8a-dimethyl-1H-cinnoline?
4,8a-dimethyl-1H-cinnoline has a molecular weight of 160.22 g/mol, XLogP of 1.78, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8a-dimethyl-1H-cinnoline is sourced from PubChem (CID 174325542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).