C13H20N2O4 — CID 174326195
2-(methoxycarbonylamino)-3-methylpentanoic acid;pyridine (PubChem CID 174326195) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-(methoxycarbonylamino)-3-methylpentanoic acid;pyridine.
| Compound Name | 2-(methoxycarbonylamino)-3-methylpentanoic acid;pyridine |
|---|---|
| PubChem CID | 174326195 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-(methoxycarbonylamino)-3-methylpentanoic acid;pyridine |
| SMILES | CCC(C)C(NC(=O)OC)C(=O)O.c1ccncc1 |
| InChI | InChI=1S/C8H15NO4.C5H5N/c1-4-5(2)6(7(10)11)9-8(12)13-3;1-2-4-6-5-3-1/h5-6H,4H2,1-3H3,(H,9,12)(H,10,11);1-5H |
| InChIKey | GOUFHDZYNQXUPH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |