C16H30N2S — CID 174326396
1-[2-(7-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethyl]-1-methylthiourea (PubChem CID 174326396) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is 1-[2-(7-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethyl]-1-methylthiourea.
| Compound Name | 1-[2-(7-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethyl]-1-methylthiourea |
|---|---|
| PubChem CID | 174326396 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-[2-(7-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethyl]-1-methylthiourea |
| SMILES | CCC1CCC2CCCC(CCN(C)C(N)=S)C2C1 |
| InChI | InChI=1S/C16H30N2S/c1-3-12-7-8-13-5-4-6-14(15(13)11-12)9-10-18(2)16(17)19/h12-15H,3-11H2,1-2H3,(H2,17,19) |
| InChIKey | KZUKDZOLXFHVOD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|