C22H35F3N4O3 — CID 174327298
(2S,5S)-5-butan-2-yl-2-(2-methylpropyl)-7-(piperidin-4-ylmethyl)-1-(2,2,2-trifluoroacetyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione (PubChem CID 174327298) has the molecular formula C22H35F3N4O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is (2S,5S)-5-butan-2-yl-2-(2-methylpropyl)-7-(piperidin-4-ylmethyl)-1-(2,2,2-trifluoroacetyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione.
| Compound Name | (2S,5S)-5-butan-2-yl-2-(2-methylpropyl)-7-(piperidin-4-ylmethyl)-1-(2,2,2-trifluoroacetyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione |
|---|---|
| PubChem CID | 174327298 |
| Molecular Formula | C22H35F3N4O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | (2S,5S)-5-butan-2-yl-2-(2-methylpropyl)-7-(piperidin-4-ylmethyl)-1-(2,2,2-trifluoroacetyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione |
| SMILES | CCC(C)[C@H]1C(=O)N(CC2CCNCC2)CC2N1C(=O)[C@H](CC(C)C)N2C(=O)C(F)(F)F |
| InChI | InChI=1S/C22H35F3N4O3/c1-5-14(4)18-20(31)27(11-15-6-8-26-9-7-15)12-17-28(21(32)22(23,24)25)16(10-13(2)3)19(30)29(17)18/h13-18,26H,5-12H2,1-4H3/t14?,16-,17?,18-/m0/s1 |
| InChIKey | AVVCDVBXDJNXPK-STCOUPBVSA-N |
| XLogP | 2.22 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |