C24H26F2N6O2 — CID 174329037
N-[[4-[amino-[(Z)-2-amino-2-quinoxalin-6-ylethenyl]amino]cyclohexyl]methyl]-3,5-difluoro-4-hydroxybenzamide (PubChem CID 174329037) has the molecular formula C24H26F2N6O2 and a molecular weight of 468.51 g/mol. Its IUPAC name is N-[[4-[amino-[(Z)-2-amino-2-quinoxalin-6-ylethenyl]amino]cyclohexyl]methyl]-3,5-difluoro-4-hydroxybenzamide.
| Compound Name | N-[[4-[amino-[(Z)-2-amino-2-quinoxalin-6-ylethenyl]amino]cyclohexyl]methyl]-3,5-difluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 174329037 |
| Molecular Formula | C24H26F2N6O2 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N-[[4-[amino-[(Z)-2-amino-2-quinoxalin-6-ylethenyl]amino]cyclohexyl]methyl]-3,5-difluoro-4-hydroxybenzamide |
| SMILES | N/C(=C\N(N)C1CCC(CNC(=O)c2cc(F)c(O)c(F)c2)CC1)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C24H26F2N6O2/c25-18-9-16(10-19(26)23(18)33)24(34)31-12-14-1-4-17(5-2-14)32(28)13-20(27)15-3-6-21-22(11-15)30-8-7-29-21/h3,6-11,13-14,17,33H,1-2,4-5,12,27-28H2,(H,31,34)/b20-13- |
| InChIKey | MXQNRUUNYGNSBK-MOSHPQCFSA-N |
| XLogP | 3.04 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|