C17H16FNO2S — CID 17432923
N-[[4-[2-(4-fluorophenyl)sulfanylacetyl]phenyl]methyl]acetamide (PubChem CID 17432923) has the molecular formula C17H16FNO2S and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[[4-[2-(4-fluorophenyl)sulfanylacetyl]phenyl]methyl]acetamide.
| Compound Name | N-[[4-[2-(4-fluorophenyl)sulfanylacetyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 17432923 |
| Molecular Formula | C17H16FNO2S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-[[4-[2-(4-fluorophenyl)sulfanylacetyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C(=O)CSc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H16FNO2S/c1-12(20)19-10-13-2-4-14(5-3-13)17(21)11-22-16-8-6-15(18)7-9-16/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | IDJAIEUMQZGYPT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |