C46H34N4 — CID 174330295
2-(6-cyclohexa-1,5-dien-1-ylcyclohexa-1,3-dien-1-yl)-4-phenyl-6-[3-(10-pyridin-3-ylanthracen-9-yl)phenyl]-1,3,5-triazine (PubChem CID 174330295) has the molecular formula C46H34N4 and a molecular weight of 642.81 g/mol. Its IUPAC name is 2-(6-cyclohexa-1,5-dien-1-ylcyclohexa-1,3-dien-1-yl)-4-phenyl-6-[3-(10-pyridin-3-ylanthracen-9-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(6-cyclohexa-1,5-dien-1-ylcyclohexa-1,3-dien-1-yl)-4-phenyl-6-[3-(10-pyridin-3-ylanthracen-9-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 174330295 |
| Molecular Formula | C46H34N4 |
| Molecular Weight | 642.81 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 2-(6-cyclohexa-1,5-dien-1-ylcyclohexa-1,3-dien-1-yl)-4-phenyl-6-[3-(10-pyridin-3-ylanthracen-9-yl)phenyl]-1,3,5-triazine |
| SMILES | C1=CCC(C2=CCCC=C2)C(c2nc(-c3ccccc3)nc(-c3cccc(-c4c5ccccc5c(-c5cccnc5)c5ccccc45)c3)n2)=C1 |
| InChI | InChI=1S/C46H34N4/c1-3-15-31(16-4-1)36-22-7-12-27-41(36)46-49-44(32-17-5-2-6-18-32)48-45(50-46)34-20-13-19-33(29-34)42-37-23-8-10-25-39(37)43(35-21-14-28-47-30-35)40-26-11-9-24-38(40)42/h2-3,5-21,23-30,36H,1,4,22H2 |
| InChIKey | PCIVLYULCKJJJL-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.81 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|