About N,N-dimethylmethanamine;methoxyperoxymethane
N,N-dimethylmethanamine;methoxyperoxymethane (PubChem CID 174331253) has the molecular formula C5H15NO3
and a molecular weight of 137.18 g/mol. Its IUPAC name is N,N-dimethylmethanamine;methoxyperoxymethane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;methoxyperoxymethane |
| PubChem CID | 174331253 |
| Molecular Formula | C5H15NO3 |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.11 |
| IUPAC Name | N,N-dimethylmethanamine;methoxyperoxymethane |
| SMILES | CN(C)C.COOOC |
| InChI | InChI=1S/C3H9N.C2H6O3/c1-4(2)3;1-3-5-4-2/h1-3H3;1-2H3 |
| InChIKey | OYQAGDGDTWMGNC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;methoxyperoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;methoxyperoxymethane?
The IUPAC name of N,N-dimethylmethanamine;methoxyperoxymethane (CID 174331253) is N,N-dimethylmethanamine;methoxyperoxymethane.
What is the SMILES notation for N,N-dimethylmethanamine;methoxyperoxymethane?
The canonical SMILES for N,N-dimethylmethanamine;methoxyperoxymethane is CN(C)C.COOOC.
What is the InChIKey of N,N-dimethylmethanamine;methoxyperoxymethane?
The InChIKey is OYQAGDGDTWMGNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H6O3/c1-4(2)3;1-3-5-4-2/h1-3H3;1-2H3.
What are the key properties of N,N-dimethylmethanamine;methoxyperoxymethane?
N,N-dimethylmethanamine;methoxyperoxymethane has a molecular weight of 137.18 g/mol, XLogP of 0.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;methoxyperoxymethane is sourced from PubChem (CID 174331253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).