About N,N-dimethyl-1,1-bis(methylperoxy)methanamine
N,N-dimethyl-1,1-bis(methylperoxy)methanamine (PubChem CID 23441001) has the molecular formula C5H13NO4
and a molecular weight of 151.16 g/mol. Its IUPAC name is N,N-dimethyl-1,1-bis(methylperoxy)methanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-1,1-bis(methylperoxy)methanamine |
| PubChem CID | 23441001 |
| Molecular Formula | C5H13NO4 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | N,N-dimethyl-1,1-bis(methylperoxy)methanamine |
| SMILES | COOC(OOC)N(C)C |
| InChI | InChI=1S/C5H13NO4/c1-6(2)5(9-7-3)10-8-4/h5H,1-4H3 |
| InChIKey | YFKAOVPMZLHAFC-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-1,1-bis(methylperoxy)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1,1-bis(methylperoxy)methanamine?
The IUPAC name of N,N-dimethyl-1,1-bis(methylperoxy)methanamine (CID 23441001) is N,N-dimethyl-1,1-bis(methylperoxy)methanamine.
What is the SMILES notation for N,N-dimethyl-1,1-bis(methylperoxy)methanamine?
The canonical SMILES for N,N-dimethyl-1,1-bis(methylperoxy)methanamine is COOC(OOC)N(C)C.
What is the InChIKey of N,N-dimethyl-1,1-bis(methylperoxy)methanamine?
The InChIKey is YFKAOVPMZLHAFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO4/c1-6(2)5(9-7-3)10-8-4/h5H,1-4H3.
What are the key properties of N,N-dimethyl-1,1-bis(methylperoxy)methanamine?
N,N-dimethyl-1,1-bis(methylperoxy)methanamine has a molecular weight of 151.16 g/mol, XLogP of -0.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1,1-bis(methylperoxy)methanamine is sourced from PubChem (CID 23441001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).