C12H16N2O6S — CID 174331806
4-amino-2-phenylmethoxycarbonyl-4-sulfamoylbutanoic acid (PubChem CID 174331806) has the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. Its IUPAC name is 4-amino-2-phenylmethoxycarbonyl-4-sulfamoylbutanoic acid.
| Compound Name | 4-amino-2-phenylmethoxycarbonyl-4-sulfamoylbutanoic acid |
|---|---|
| PubChem CID | 174331806 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 4-amino-2-phenylmethoxycarbonyl-4-sulfamoylbutanoic acid |
| SMILES | NC(CC(C(=O)O)C(=O)OCc1ccccc1)S(N)(=O)=O |
| InChI | InChI=1S/C12H16N2O6S/c13-10(21(14,18)19)6-9(11(15)16)12(17)20-7-8-4-2-1-3-5-8/h1-5,9-10H,6-7,13H2,(H,15,16)(H2,14,18,19) |
| InChIKey | SRVQVLCLXAPLAO-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|