C11H14N2O6S — CID 174251268
2-[amino(sulfamoyl)methyl]-3-oxo-3-phenylmethoxypropanoic acid (PubChem CID 174251268) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-[amino(sulfamoyl)methyl]-3-oxo-3-phenylmethoxypropanoic acid.
| Compound Name | 2-[amino(sulfamoyl)methyl]-3-oxo-3-phenylmethoxypropanoic acid |
|---|---|
| PubChem CID | 174251268 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-[amino(sulfamoyl)methyl]-3-oxo-3-phenylmethoxypropanoic acid |
| SMILES | NC(C(C(=O)O)C(=O)OCc1ccccc1)S(N)(=O)=O |
| InChI | InChI=1S/C11H14N2O6S/c12-9(20(13,17)18)8(10(14)15)11(16)19-6-7-4-2-1-3-5-7/h1-5,8-9H,6,12H2,(H,14,15)(H2,13,17,18) |
| InChIKey | JBXLLYAWHVLBSS-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|