C52H43NO — CID 174333356
4-[3-[1-[3-[1-(3,5-dimethylphenyl)-2-methylprop-2-enoxy]-2-methylphenyl]naphthalen-2-yl]phenyl]-2,6-diphenylpyridine (PubChem CID 174333356) has the molecular formula C52H43NO and a molecular weight of 697.92 g/mol. Its IUPAC name is 4-[3-[1-[3-[1-(3,5-dimethylphenyl)-2-methylprop-2-enoxy]-2-methylphenyl]naphthalen-2-yl]phenyl]-2,6-diphenylpyridine.
| Compound Name | 4-[3-[1-[3-[1-(3,5-dimethylphenyl)-2-methylprop-2-enoxy]-2-methylphenyl]naphthalen-2-yl]phenyl]-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 174333356 |
| Molecular Formula | C52H43NO |
| Molecular Weight | 697.92 g/mol |
| Exact Mass | 697.33 |
| IUPAC Name | 4-[3-[1-[3-[1-(3,5-dimethylphenyl)-2-methylprop-2-enoxy]-2-methylphenyl]naphthalen-2-yl]phenyl]-2,6-diphenylpyridine |
| SMILES | C=C(C)C(Oc1cccc(-c2c(-c3cccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)c3)ccc3ccccc23)c1C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C52H43NO/c1-34(2)52(44-29-35(3)28-36(4)30-44)54-50-25-15-24-45(37(50)5)51-46-23-13-12-16-38(46)26-27-47(51)42-22-14-21-41(31-42)43-32-48(39-17-8-6-9-18-39)53-49(33-43)40-19-10-7-11-20-40/h6-33,52H,1H2,2-5H3 |
| InChIKey | PQWVTBASDIKNEF-UHFFFAOYSA-N |
| XLogP | 14.19 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.92 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|