C21H25BrO3 — CID 174335614
4-[4-(4-bromobutoxy)-3-phenylphenyl]pentanoic acid (PubChem CID 174335614) has the molecular formula C21H25BrO3 and a molecular weight of 405.33 g/mol. Its IUPAC name is 4-[4-(4-bromobutoxy)-3-phenylphenyl]pentanoic acid.
| Compound Name | 4-[4-(4-bromobutoxy)-3-phenylphenyl]pentanoic acid |
|---|---|
| PubChem CID | 174335614 |
| Molecular Formula | C21H25BrO3 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 4-[4-(4-bromobutoxy)-3-phenylphenyl]pentanoic acid |
| SMILES | CC(CCC(=O)O)c1ccc(OCCCCBr)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H25BrO3/c1-16(9-12-21(23)24)18-10-11-20(25-14-6-5-13-22)19(15-18)17-7-3-2-4-8-17/h2-4,7-8,10-11,15-16H,5-6,9,12-14H2,1H3,(H,23,24) |
| InChIKey | FYHFOXNJVQJURG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|