C22H26N4O — CID 174335677
[4-[(Z,2E)-2-ethylidene-1-phenylpent-3-enyl]piperazin-1-yl]-pyridazin-3-ylmethanone (PubChem CID 174335677) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is [4-[(Z,2E)-2-ethylidene-1-phenylpent-3-enyl]piperazin-1-yl]-pyridazin-3-ylmethanone.
| Compound Name | [4-[(Z,2E)-2-ethylidene-1-phenylpent-3-enyl]piperazin-1-yl]-pyridazin-3-ylmethanone |
|---|---|
| PubChem CID | 174335677 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [4-[(Z,2E)-2-ethylidene-1-phenylpent-3-enyl]piperazin-1-yl]-pyridazin-3-ylmethanone |
| SMILES | C/C=C\C(=C/C)C(c1ccccc1)N1CCN(C(=O)c2cccnn2)CC1 |
| InChI | InChI=1S/C22H26N4O/c1-3-9-18(4-2)21(19-10-6-5-7-11-19)25-14-16-26(17-15-25)22(27)20-12-8-13-23-24-20/h3-13,21H,14-17H2,1-2H3/b9-3-,18-4+ |
| InChIKey | HQZKFWAVOKGORY-ARTXGEKBSA-N |
| XLogP | 3.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|