C33H38FN3O — CID 72518146
2-(dibenzylamino)-1-[4-[2-ethylidene-1-(4-fluorophenyl)pent-3-enyl]piperazin-1-yl]ethanone (PubChem CID 72518146) has the molecular formula C33H38FN3O and a molecular weight of 511.69 g/mol. Its IUPAC name is 2-(dibenzylamino)-1-[4-[2-ethylidene-1-(4-fluorophenyl)pent-3-enyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(dibenzylamino)-1-[4-[2-ethylidene-1-(4-fluorophenyl)pent-3-enyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 72518146 |
| Molecular Formula | C33H38FN3O |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | 2-(dibenzylamino)-1-[4-[2-ethylidene-1-(4-fluorophenyl)pent-3-enyl]piperazin-1-yl]ethanone |
| SMILES | CC=CC(=CC)C(c1ccc(F)cc1)N1CCN(C(=O)CN(Cc2ccccc2)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C33H38FN3O/c1-3-11-29(4-2)33(30-16-18-31(34)19-17-30)37-22-20-36(21-23-37)32(38)26-35(24-27-12-7-5-8-13-27)25-28-14-9-6-10-15-28/h3-19,33H,20-26H2,1-2H3 |
| InChIKey | RTVBVFPLCGOEFC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|