C20H22FN3O3 — CID 163876395
2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-N-hydroxy-2-phenylacetamide (PubChem CID 163876395) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is 2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-N-hydroxy-2-phenylacetamide.
| Compound Name | 2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-N-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 163876395 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-N-hydroxy-2-phenylacetamide |
| SMILES | O=C(NO)C(c1ccccc1)N1CCN(C(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22FN3O3/c21-17-8-6-15(7-9-17)14-18(25)23-10-12-24(13-11-23)19(20(26)22-27)16-4-2-1-3-5-16/h1-9,19,27H,10-14H2,(H,22,26) |
| InChIKey | PPGDDSZMPKTFKM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|