C6H11FeNO7 — CID 174337721
azane;2-hydroxypropane-1,1,1-tricarboxylic acid;iron (PubChem CID 174337721) has the molecular formula C6H11FeNO7 and a molecular weight of 265.00 g/mol. Its IUPAC name is azane;2-hydroxypropane-1,1,1-tricarboxylic acid;iron.
| Compound Name | azane;2-hydroxypropane-1,1,1-tricarboxylic acid;iron |
|---|---|
| PubChem CID | 174337721 |
| Molecular Formula | C6H11FeNO7 |
| Molecular Weight | 265.00 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | azane;2-hydroxypropane-1,1,1-tricarboxylic acid;iron |
| SMILES | CC(O)C(C(=O)O)(C(=O)O)C(=O)O.N.[Fe] |
| InChI | InChI=1S/C6H8O7.Fe.H3N/c1-2(7)6(3(8)9,4(10)11)5(12)13;;/h2,7H,1H3,(H,8,9)(H,10,11)(H,12,13);;1H3 |
| InChIKey | CRSGISBOHBWGTH-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 167.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.00 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|