About 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene
5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene (PubChem CID 174339187) has the molecular formula C19H13F5S
and a molecular weight of 368.37 g/mol. Its IUPAC name is 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene.
Molecular Properties
| Compound Name | 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene |
| PubChem CID | 174339187 |
| Molecular Formula | C19H13F5S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene |
| SMILES | Cc1ccc(-c2cc(F)c(-c3cc(C)c(C(F)(F)F)s3)c(F)c2)cc1 |
| InChI | InChI=1S/C19H13F5S/c1-10-3-5-12(6-4-10)13-8-14(20)17(15(21)9-13)16-7-11(2)18(25-16)19(22,23)24/h3-9H,1-2H3 |
| InChIKey | KWUGYFSKOOZODB-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene?
The IUPAC name of 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene (CID 174339187) is 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene.
What is the SMILES notation for 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene?
The canonical SMILES for 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene is Cc1ccc(-c2cc(F)c(-c3cc(C)c(C(F)(F)F)s3)c(F)c2)cc1.
What is the InChIKey of 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene?
The InChIKey is KWUGYFSKOOZODB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F5S/c1-10-3-5-12(6-4-10)13-8-14(20)17(15(21)9-13)16-7-11(2)18(25-16)19(22,23)24/h3-9H,1-2H3.
What are the key properties of 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene?
5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene has a molecular weight of 368.37 g/mol, XLogP of 7.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,6-difluoro-4-(4-methylphenyl)phenyl]-3-methyl-2-(trifluoromethyl)thiophene is sourced from PubChem (CID 174339187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).