About N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide
N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide (PubChem CID 174339591) has the molecular formula C7H18FNO2S2
and a molecular weight of 231.36 g/mol. Its IUPAC name is N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide |
| PubChem CID | 174339591 |
| Molecular Formula | C7H18FNO2S2 |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide |
| SMILES | CN(CCCS(C)(C)F)S(C)(=O)=O |
| InChI | InChI=1S/C7H18FNO2S2/c1-9(13(4,10)11)6-5-7-12(2,3)8/h5-7H2,1-4H3 |
| InChIKey | BDBFWHZATSFEHT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide?
The IUPAC name of N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide (CID 174339591) is N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide is CN(CCCS(C)(C)F)S(C)(=O)=O.
What is the InChIKey of N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide?
The InChIKey is BDBFWHZATSFEHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18FNO2S2/c1-9(13(4,10)11)6-5-7-12(2,3)8/h5-7H2,1-4H3.
What are the key properties of N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide?
N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide has a molecular weight of 231.36 g/mol, XLogP of 1.22, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[fluoro(dimethyl)-λ4-sulfanyl]propyl]-N-methylmethanesulfonamide is sourced from PubChem (CID 174339591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).