C7H14N2O2 — CID 174341959
N-methyl-3,7-dioxa-9-azabicyclo[3.3.1]nonan-9-amine (PubChem CID 174341959) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is N-methyl-3,7-dioxa-9-azabicyclo[3.3.1]nonan-9-amine.
| Compound Name | N-methyl-3,7-dioxa-9-azabicyclo[3.3.1]nonan-9-amine |
|---|---|
| PubChem CID | 174341959 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | N-methyl-3,7-dioxa-9-azabicyclo[3.3.1]nonan-9-amine |
| SMILES | CNN1C2COCC1COC2 |
| InChI | InChI=1S/C7H14N2O2/c1-8-9-6-2-10-4-7(9)5-11-3-6/h6-8H,2-5H2,1H3 |
| InChIKey | JVPIFIALACAZDH-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |