C15H20F2 — CID 174343858
1-fluoro-4-[(Z)-3-fluoro-2,4-dimethylhex-4-en-3-yl]-2-methylbenzene (PubChem CID 174343858) has the molecular formula C15H20F2 and a molecular weight of 238.32 g/mol. Its IUPAC name is 1-fluoro-4-[(Z)-3-fluoro-2,4-dimethylhex-4-en-3-yl]-2-methylbenzene.
| Compound Name | 1-fluoro-4-[(Z)-3-fluoro-2,4-dimethylhex-4-en-3-yl]-2-methylbenzene |
|---|---|
| PubChem CID | 174343858 |
| Molecular Formula | C15H20F2 |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-fluoro-4-[(Z)-3-fluoro-2,4-dimethylhex-4-en-3-yl]-2-methylbenzene |
| SMILES | C/C=C(/C)C(F)(c1ccc(F)c(C)c1)C(C)C |
| InChI | InChI=1S/C15H20F2/c1-6-12(5)15(17,10(2)3)13-7-8-14(16)11(4)9-13/h6-10H,1-5H3/b12-6- |
| InChIKey | NZYBBIPAZNGDDL-SDQBBNPISA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|